| Directory |
Trade Leads |
Rated |
Visits |
Date |
Images |
Acids, Oxygen, Sulfur
 |
 Gases
Air,Ammonia (NH3),Argon (Ar),Arsine (AsH3),Boron Trichloride (BCL3),Boron Trifluoride (BF3),n-Butane (n-C4H10),Carbon Dioxide (CO2),Carbon Monoxide (CO),Carbonyl Sulfide(COS),Chlorine (CL2),Chlo
Air,Ammonia (NH3),Argon (Ar),Arsine (AsH3),Boron Trichloride (BCL3),Boron Trifluoride (BF3),n-Butane (n-C4H10),Carbon Dioxide (CO2),Carbon Monoxide (CO),Carbonyl Sulfide(COS),Chlorine (CL2),Chlorine T... |
0 (#0) |
16 |
2013.05.13 |
 |
Acids, Oxygen, Sulfur
|
p-tert-Butylbenzoic acid (PTBBA)
Manufacture 4-tert-Butylbenzoic acid
CAS NO: [98-73-7]
Molecular Weight: 178.23
Other
Specifications
Assay: 99.00 %
Appearance: white crystal
-------------------------------------------------
Other properties
Ac... |
0 (#0) |
25 |
2013.03.27 |
|
Acids, Oxygen, Sulfur
|
Zinc oxide
Description:
White or light yellow powder or six-party crystabllization. No smell, bitter taste.
Zinc Oxide
99%... |
0 (#0) |
30 |
2013.03.25 |
 |
Acids, Oxygen, Sulfur
|
Stearic Acid 1865
The pure products is white slightly shiny waxy small piece of crystal.
Index 200TriplePressed 400doublepressed 800singlePressed
Iodine g/100≤ 2.0 4.0 8.0
Saponification value (mgKOH/g) 206-211 203-214 193-220
AcidValue(mgKOH/g) 205-210 202-2... |
0 (#0) |
20 |
2013.03.22 |
|
Acids, Oxygen, Sulfur
|
Calcium formate metathesis process
Calcium formateSteps and key points of operation steps and key points o
Calcium formate... |
0 (#0) |
34 |
2013.03.21 |
|
Acids, Oxygen, Sulfur
|
Soda Ash... |
0 (#0) |
49 |
2013.02.18 |
|
Acids, Oxygen, Sulfur
|
Soda Ash... |
0 (#0) |
60 |
2013.02.18 |
|
Acids, Oxygen, Sulfur
|
Soda Ash... |
0 (#0) |
49 |
2013.02.18 |
|
Acids, Oxygen, Sulfur
|
Soda Ash... |
0 (#0) |
44 |
2013.02.18 |
|
Acids, Oxygen, Sulfur
|
Soda Ash... |
0 (#0) |
50 |
2013.02.18 |
|
Acids, Oxygen, Sulfur
|
Soda Ash... |
0 (#0) |
36 |
2013.02.18 |
|
Acids, Oxygen, Sulfur
|
Soda Ash... |
0 (#0) |
40 |
2013.02.18 |
|
Acids, Oxygen, Sulfur
|
Soda Ash... |
0 (#0) |
40 |
2013.02.18 |
|
Acids, Oxygen, Sulfur
|
Soda Ash... |
0 (#0) |
66 |
2013.02.18 |
|
Acids, Oxygen, Sulfur
|
Soybean Oil Fatty Acid
1 Basic Information:
CAS NO:68308-53-2 HS Code:3823190001 EC NO:269-657-0
MF:R-C--0OH
1 Basic Information:
CAS NO:68308-53-2 HS Code:3823190001 EC NO:269-657-0
MF:R-C--0OH
2 Property:
Pale yellow transparent ,liquid ,oily shape; concreting into... |
0 (#0) |
42 |
2013.02.17 |
|
Acids, Oxygen, Sulfur
|
Soda Ash... |
0 (#0) |
45 |
2013.01.07 |
|
Acids, Oxygen, Sulfur
|
Refrigerant gas R404A
SNOW POWER R404A, 0 ODP, is an environment friendly mixed refrigerant gas.
It is a new type of&nb
Chemical Index
1.Grade: high-class
2. Chemical contents: R125/ R143A/ R134A(44:52:4)
3. Appearance: Colorless, not turbid
4. Smell: No odor
5. Purity(%): more than ... |
0 (#0) |
81 |
2012.12.27 |
|
Acids, Oxygen, Sulfur
|
Refrigerant R134A
At room temperature, SNOW POWER R134a, is a colorless, odorless, non-flammable and non-corrosive gas. When pressurized,
Chemical Index:
1. Grade: high-class
2. Appearance: Colorless, not turbid
3. Purity(%): more than 99.9
4. Moisture(%): not exceeding 0.0005
5. Acidity(Calcu... |
0 (#0) |
76 |
2012.12.27 |
|
Acids, Oxygen, Sulfur
|
Hydrochloric acid
Acrid is one of the fastest remedies to supplement hydrochloric acerbic accumulation. amidst one and 10 teaspoons of acrid in a canteen of admit can board an absolute celerity
chemical... |
0 (#0) |
41 |
2012.11.27 |
|
Acids, Oxygen, Sulfur
 |
Inorganic & organic chemicals... |
0 (#0) |
111 |
2012.11.27 |
|
Acids, Oxygen, Sulfur
|
Linear Alkylbenzene Sulphonic Acid
Active Matter (Alkyl benzene Acid) % 96 min
Free oil % 2.0 max
Sulphate % 1.5 min
Chemical Formula:CH3(CH2)11C6H4SO3H
Relative Molecular Weight: 348.48
HS: 3402110000
CAS: 27176-87-
Specification：0
Appearance: Appearance brown liquid... |
0 (#0) |
88 |
2012.07.12 |
|
Acids, Oxygen, Sulfur
|
Phosphoric acid
Industrial Phosphoric acid Phosphoric acid manufacturer Large scale sales of Phosphoric acid Shandong Phosphoric acid&
CAS No. :7664-38-2
EINECS No.:231-633-2
Chemical formula: H3PO4 ... |
0 (#0) |
87 |
2012.07.12 |
|
Acids, Oxygen, Sulfur
|
Stearic acid
Stearic acid
Other name: Octadecanoic acid English Name: octadecanoic acid
Molecular formula: C18H
CAS: 57-11-4
MF: C18H36O2
MW: 284.48
EINECS: 266-928-5... |
0 (#0) |
89 |
2012.07.12 |
|
Acids, Oxygen, Sulfur
|
Oxalic acid
99.6% Shandong 25kg/bag
Product name: Oxalic acid
Alias: Ethanedioic acid; Dicarboxylic acid
Molecular formula:
Molecular weight: 90.04
CAS No.: 144-62-7... |
0 (#0) |
77 |
2012.07.12 |
|
Acids, Oxygen, Sulfur
|
Formic acid
Formic acid
Melting point 8.4οC,
Boiling point 100.8οC
Relative density (d204) 1.220.
Formic acid price quotations Formic acid production unit Shandong Formic acid 85% Domestic 250kg/drum... |
0 (#0) |
83 |
2012.07.12 |
|
Trademetro.net Trade Leads / Chemical / Acids, Oxygen, Sulfur